Compound Q&A

How should 4-(1-Pyrrolidinyl)aniline hydrochloride (CAS: 216670-47-2) be stored?

Answer

4-(1-Pyrrolidinyl)aniline hydrochloride
4-(1-Pyrrolidinyl)aniline hydrochloride should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent moisture absorption and degradation. The storage temperature should not exceed 25°C (77°F) to ensure stability and prevent any adverse chemical changes.

About

English Name 4-(1-Pyrrolidinyl)aniline hydrochloride
Molecular Formula C10H15ClN2
Molecular Weight 198.69700000000003 g/mol
SMILES C1CCN(C1)C2=CC=C(C=C2)N.Cl
InChIKey CKZKSFMNJXRVNG-UHFFFAOYSA-N
Last Updated: 2025-12-30 22:02

Related Q&A

Compound Q&A

What is 4-(1-Pyrrolidinyl)aniline hydrochloride (CAS: 216670-47-2)?

4-(1-Pyrrolidinyl)aniline hydrochloride is a chemical compound with the molecular formula C10H14N2·H...

Compound Q&A

What are the main uses of 4-(1-Pyrrolidinyl)aniline hydrochloride (CAS: 216670-47-2)?

4-(1-Pyrrolidinyl)aniline hydrochloride is primarily used as a raw material in pharmaceuticals and a...

Compound Q&A

Is 4-(1-Pyrrolidinyl)aniline hydrochloride (CAS: 216670-47-2) safe?

4-(1-Pyrrolidinyl)aniline hydrochloride is generally considered safe when handled with proper precau...

Compound Q&A

How is hexyl(diphenyl)phosphine (CAS: 18298-00-5) typically synthesized?

Hexyl(diphenyl)phosphine is typically synthesized by the reaction of hexylmagnes...

18298-00-5Hexyl(diphenyl)phosp...
Compound Q&A

How should 2-Methyl-2-proanyl 3-amino-2-methyl-1-azetidinecarboxylate (CAS: 1368087-42-6) be stored?

2-Methyl-2-proanyl 3-amino-2-methyl-1-azetidinecarboxylate (CAS: 1368087-42-6) s...

1368087-42-62-Methyl-2-propanyl ...
Compound Q&A

What are the main uses of 4-(1-Pyrrolidinyl)aniline hydrochloride (CAS: 216670-47-2)?

4-(1-Pyrrolidinyl)aniline hydrochloride is primarily used as a raw material in p...

216670-47-24-(1-Pyrrolidinyl)an...
Compound Q&A

What industries use Tetraphenylthiophene (CAS: 1884-68-0)?

Tetraphenylthiophene (CAS: 1884-68-0) is used in various industries. It is a key...

1884-68-0Tetraphenylthiophene