Compound Q&A

How should 4,4',4'',4'''-[(6,6'-Dimethoxy-2,2'-biphenyldiyl)diphosphinetriyl]tetrakis(2,6-diisopropyl-N,N-dimethylaniline) (CAS: 352655-40-4) be stored?

Answer

4,4',4'',4'''-[(6,6'-Dimethoxy-2,2'-biphenyldiyl)diphosphinetriyl]tetrakis(2,6-diisopropyl-N,N-dimethylaniline)
This compound should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent moisture absorption. The storage area should have good ventilation to ensure the safety of personnel and proper air circulation.

About

English Name 4,4',4'',4'''-[(6,6'-Dimethoxy-2,2'-biphenyldiyl)diphosphinetriyl]tetrakis(2,6-diisopropyl-N,N-dimethylaniline)
Molecular Formula C70H100N4O2P2
Molecular Weight 1091.54 g/mol
SMILES CC(C)c1cc(cc(c1N(C)C)C(C)C)P(c2cccc(c2c3c(cccc3P(c4cc(c(c(c4)C(C)C)N(C)C)C(C)C)c5cc(c(c(c5)C(C)C)N(C)C)C(C)C)OC)OC)c6cc(c(c(c6)C(C)C)N(C)C)C(C)C
InChIKey SBQGDYGNDIQAIT-UHFFFAOYSA-N
Last Updated: 2025-12-30 22:02

Related Q&A

Compound Q&A

What is 4,4',4'',4'''-[(6,6'-Dimethoxy-2,2'-biphenyldiyl)diphosphinetriyl]tetrakis(2,6-diisopropyl-N,N-dimethylaniline) (CAS: 352655-40-4)?

This compound is a complex organophosphorus derivative with a unique structure. It consists of a dip...

Compound Q&A

What are the main uses of 4,4',4'',4'''-[(6,6'-Dimethoxy-2,2'-biphenyldiyl)diphosphinetriyl]tetrakis(2,6-diisopropyl-N,N-dimethylaniline) (CAS: 352655-40-4)?

This compound is primarily used in the synthesis of organophosphorus compounds and as a ligand in me...

Compound Q&A

Is 4,4',4'',4'''-[(6,6'-Dimethoxy-2,2'-biphenyldiyl)diphosphinetriyl]tetrakis(2,6-diisopropyl-N,N-dimethylaniline) (CAS: 352655-40-4) safe?

The compound is generally considered safe for laboratory use when proper handling procedures are fol...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...