Compound Q&A

What are the main uses of (1S,4S)-2,5-Diphenylbicyclo[2.2.2]octa-2,5-diene (CAS: 850409-83-5)?

Answer

(1S,4S)-2,5-Diphenylbicyclo[2.2.2]octa-2,5-diene
(1S,4S)-2,5-Diphenylbicyclo[2.2.2]octa-2,5-diene (CAS: 850409-83-5) is mainly used in pharmaceutical and research applications. It serves as a building block for synthesizing more complex molecules and has potential as a drug candidate due to its unique structural features.

About

English Name (1S,4S)-2,5-Diphenylbicyclo[2.2.2]octa-2,5-diene
Molecular Formula C20H18
Molecular Weight 258.36 g/mol
SMILES [H][C@@]1(CC2)C(C3=CC=CC=C3)=C[C@@]2([H])C(C4=CC=CC=C4)=C1
InChIKey BDYBOFJAEBJDMI-ROUUACIJSA-N
Last Updated: 2025-12-30 18:17

Related Q&A

Compound Q&A

What is (1S,4S)-2,5-Diphenylbicyclo[2.2.2]octa-2,5-diene (CAS: 850409-83-5)?

(1S,4S)-2,5-Diphenylbicyclo[2.2.2]octa-2,5-diene is an organic compound with the CAS number 850409-8...

Compound Q&A

Is (1S,4S)-2,5-Diphenylbicyclo[2.2.2]octa-2,5-diene (CAS: 850409-83-5) safe?

(1S,4S)-2,5-Diphenylbicyclo[2.2.2]octa-2,5-diene (CAS: 850409-83-5) is generally safe when handled w...

Compound Q&A

How should (1S,4S)-2,5-Diphenylbicyclo[2.2.2]octa-2,5-diene (CAS: 850409-83-5) be stored?

(1S,4S)-2,5-Diphenylbicyclo[2.2.2]octa-2,5-diene (CAS: 850409-83-5) should be stored in a cool, dry ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...