Compound Q&A

What is 2-(4-Hydroxyphenyl)-3-[(4-methoxybenzyl)oxy]-3-oxopropanoic acid (CAS: 78641-40-4)?

Answer

2-(4-Hydroxyphenyl)-3-[(4-methoxybenzyl)oxy]-3-oxopropanoic acid
2-(4-Hydroxyphenyl)-3-[(4-methoxybenzyl)oxy]-3-oxopropanoic acid is a chemical compound with the CAS number 78641-40-4. It is a white to off-white crystalline powder with a molecular formula of C17H18O6 and a molecular weight of approximately 318.34. This compound is characterized by its hydroxy and methoxy functional groups, making it versatile in various applications.

About

CAS No 78641-40-4
English Name 2-(4-Hydroxyphenyl)-3-[(4-methoxybenzyl)oxy]-3-oxopropanoic acid
Molecular Formula C17H16O6
Molecular Weight 316.31 g/mol
SMILES COC1=CC=C(C=C1)COC(=O)C(C2=CC=C(C=C2)O)C(=O)O
InChIKey JHALLYTYXLWETG-UHFFFAOYSA-N
Last Updated: 2025-12-30 18:17

Related Q&A

Compound Q&A

What are the main uses of 2-(4-Hydroxyphenyl)-3-[(4-methoxybenzyl)oxy]-3-oxopropanoic acid (CAS: 78641-40-4)?

2-(4-Hydroxyphenyl)-3-[(4-methoxybenzyl)oxy]-3-oxopropanoic acid is primarily used in pharmaceutical...

Compound Q&A

Is 2-(4-Hydroxyphenyl)-3-[(4-methoxybenzyl)oxy]-3-oxopropanoic acid (CAS: 78641-40-4) safe?

2-(4-Hydroxyphenyl)-3-[(4-methoxybenzyl)oxy]-3-oxopropanoic acid is generally considered safe for it...

Compound Q&A

How should 2-(4-Hydroxyphenyl)-3-[(4-methoxybenzyl)oxy]-3-oxopropanoic acid (CAS: 78641-40-4) be stored?

2-(4-Hydroxyphenyl)-3-[(4-methoxybenzyl)oxy]-3-oxopropanoic acid should be stored in a cool, dry pla...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...