Compound Q&A

What are the main uses of 3-Carbamoyl-1,4-dimethylpyridinium chloride (CAS: 110999-36-5)?

Answer

3-Carbamoyl-1,4-dimethylpyridinium chloride
3-Carbamoyl-1,4-dimethylpyridinium chloride is primarily used in pharmaceuticals as a reagent for the synthesis of other compounds. It also finds applications in the chemical industry for its reactivity and stability. Additionally, it is used in research for its specific functional groups, which are valuable in organic synthesis.

About

English Name 3-Carbamoyl-1,4-dimethylpyridinium chloride
Molecular Formula C8H11ClN2O
Molecular Weight 186.64 g/mol
SMILES CC1=C(C=[N+](C=C1)C)C(=O)N.[Cl-]
InChIKey DFKMKEGJTOGPAX-UHFFFAOYSA-N
Last Updated: 2025-12-30 18:17

Related Q&A

Compound Q&A

What is 3-Carbamoyl-1,4-dimethylpyridinium chloride (CAS: 110999-36-5)?

3-Carbamoyl-1,4-dimethylpyridinium chloride is a chemical compound with the formula C8H12N3OCl. This...

Compound Q&A

Is 3-Carbamoyl-1,4-dimethylpyridinium chloride (CAS: 110999-36-5) safe?

3-Carbamoyl-1,4-dimethylpyridinium chloride is generally considered safe when used under proper safe...

Compound Q&A

How should 3-Carbamoyl-1,4-dimethylpyridinium chloride (CAS: 110999-36-5) be stored?

3-Carbamoyl-1,4-dimethylpyridinium chloride should be stored in a tightly sealed container to protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...