Compound Q&A

How should 5-Chloro-4-fluoro-1H-indole-2-carboxylic acid (CAS: 186446-26-4) be stored?

Answer

5-Chloro-4-fluoro-1H-indole-2-carboxylic acid
5-Chloro-4-fluoro-1H-indole-2-carboxylic acid (CAS: 186446-26-4) should be stored in a cool, dry place, away from direct sunlight and heat sources. It is recommended to store it in a tightly sealed container to prevent degradation and contamination. Proper labeling and adherence to chemical storage best practices are essential to ensure safety and efficacy.

About

English Name 5-Chloro-4-fluoro-1H-indole-2-carboxylic acid
Molecular Formula C9H5ClFNO2
Molecular Weight 213.6 g/mol
SMILES C1=CC(=C(C2=C1NC(=C2)C(=O)O)F)Cl
InChIKey GOPLNYXPDXOWSO-UHFFFAOYSA-N
Last Updated: 2025-12-30 18:16

Related Q&A

Compound Q&A

What is 5-Chloro-4-fluoro-1H-indole-2-carboxylic acid (CAS: 186446-26-4)?

5-Chloro-4-fluoro-1H-indole-2-carboxylic acid (CAS: 186446-26-4) is a derivative of indole with a ca...

Compound Q&A

What are the main uses of 5-Chloro-4-fluoro-1H-indole-2-carboxylic acid (CAS: 186446-26-4)?

5-Chloro-4-fluoro-1H-indole-2-carboxylic acid (CAS: 186446-26-4) is primarily used in the pharmaceut...

Compound Q&A

Is 5-Chloro-4-fluoro-1H-indole-2-carboxylic acid (CAS: 186446-26-4) safe?

5-Chloro-4-fluoro-1H-indole-2-carboxylic acid (CAS: 186446-26-4) is generally considered safe when h...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...