Compound Q&A

What is 5-Cyano-2,3-di-p-tolyltetrazolium chloride (CAS: 90217-02-0)?

Answer

5-Cyano-2,3-di-p-tolyltetrazolium chloride
5-Cyano-2,3-di-p-tolyltetrazolium chloride, also known as CT, is a chemical compound with the CAS number 90217-02-0. It is a yellow crystalline solid with a molecular formula of C22H20ClN5. This compound is widely used in biological and chemical research for its labeling and detection properties.

About

CAS No 90217-02-0
English Name 5-Cyano-2,3-di-p-tolyltetrazolium chloride
Molecular Formula C16H16ClN5
Molecular Weight 313.78 g/mol
SMILES CC1=CC=C(C=C1)N2N=C(N=[N+]2C3=CC=C(C=C3)C)C#N.[Cl-]
InChIKey QGZKDVFQNNGYKY-UHFFFAOYSA-N
Last Updated: 2025-12-30 18:16

Related Q&A

Compound Q&A

What are the main uses of 5-Cyano-2,3-di-p-tolyltetrazolium chloride (CAS: 90217-02-0)?

5-Cyano-2,3-di-p-tolyltetrazolium chloride is primarily used in biological research for cell viabili...

Compound Q&A

Is 5-Cyano-2,3-di-p-tolyltetrazolium chloride (CAS: 90217-02-0) safe?

5-Cyano-2,3-di-p-tolyltetrazolium chloride is generally considered safe when used as directed. Howev...

Compound Q&A

How should 5-Cyano-2,3-di-p-tolyltetrazolium chloride (CAS: 90217-02-0) be stored?

5-Cyano-2,3-di-p-tolyltetrazolium chloride should be stored in a cool, dry place, away from direct s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...