Compound Q&A

How should 2-Bromo-4-(trifluoromethyl)phenylboronic acid (CAS: 959997-88-7) be stored?

Answer

2-Bromo-4-(trifluoromethyl)phenylboronic acid
2-Bromo-4-(trifluoromethyl)phenylboronic acid should be stored in a cool, dry place away from direct sunlight and heat sources. It is recommended to keep it in a tightly sealed container to prevent moisture absorption. Refrigeration is not necessary but can be considered if the compound is to be stored for extended periods.

About

English Name 2-Bromo-4-(trifluoromethyl)phenylboronic acid
Molecular Formula C7H5BBrF3O2
Molecular Weight 268.82 g/mol
SMILES B(C1=C(C=C(C=C1)C(F)(F)F)Br)(O)O
InChIKey WMKPVTIMXOLNHA-UHFFFAOYSA-N
Last Updated: 2025-12-30 18:16

Related Q&A

Compound Q&A

What is 2-Bromo-4-(trifluoromethyl)phenylboronic acid (CAS: 959997-88-7)?

2-Bromo-4-(trifluoromethyl)phenylboronic acid is an organic compound with the CAS number 959997-88-7...

Compound Q&A

What are the main uses of 2-Bromo-4-(trifluoromethyl)phenylboronic acid (CAS: 959997-88-7)?

2-Bromo-4-(trifluoromethyl)phenylboronic acid is primarily used in pharmaceutical research for the s...

Compound Q&A

Is 2-Bromo-4-(trifluoromethyl)phenylboronic acid (CAS: 959997-88-7) safe?

2-Bromo-4-(trifluoromethyl)phenylboronic acid is generally considered safe when handled with appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...