Compound Q&A

How should N-Benzoyl-L-norvaline (CAS: 121470-62-0) be stored?

Answer

N-Benzoyl-L-norvaline
N-Benzoyl-L-norvaline (CAS: 121470-62-0) should be stored in a tightly sealed container, protected from light and moisture. Store at room temperature, ideally between 15°C and 25°C, and avoid exposure to direct sunlight and high humidity.

About

English Name N-Benzoyl-L-norvaline
Molecular Formula C12H15NO3
Molecular Weight 221.256 g/mol
SMILES CCC[C@@H](C(=O)O)NC(=O)c1ccccc1
InChIKey PZIVHOLHABBQKU-JTQLQIEISA-N
Last Updated: 2025-12-30 18:16

Related Q&A

Compound Q&A

What is N-Benzoyl-L-norvaline (CAS: 121470-62-0)?

N-Benzoyl-L-norvaline (CAS: 121470-62-0) is a synthetic amino acid derivative with a benzoyl group a...

Compound Q&A

What are the main uses of N-Benzoyl-L-norvaline (CAS: 121470-62-0)?

N-Benzoyl-L-norvaline (CAS: 121470-62-0) is primarily used in the pharmaceutical industry as an inte...

Compound Q&A

Is N-Benzoyl-L-norvaline (CAS: 121470-62-0) safe?

N-Benzoyl-L-norvaline (CAS: 121470-62-0) is generally safe when used and handled according to safety...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...