Compound Q&A

How should 7-({(2-Amino-1,3-thiazol-4-yl)[(carboxymethoxy)imino]acetyl}amino)-8-oxo-3-vinyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS: 108691-83-4) be stored?

Answer

7-({(2-Amino-1,3-thiazol-4-yl)[(carboxymethoxy)imino]acetyl}amino)-8-oxo-3-vinyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
This compound should be stored at a temperature between 15-25°C, in a sealed container to protect it from moisture and light. It is crucial to keep it away from direct sunlight and to store it in a well-ventilated area. The container should be tightly sealed when not in use to prevent degradation or contamination.

About

English Name 7-({(2-Amino-1,3-thiazol-4-yl)[(carboxymethoxy)imino]acetyl}amino)-8-oxo-3-vinyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
Molecular Formula C16H15N5O7S2
Molecular Weight 453.46 g/mol
SMILES C=CC1=C(N2C(C(C2=O)NC(=O)C(=NOCC(=O)O)c3csc(n3)N)SC1)C(=O)O
InChIKey OKBVVJOGVLARMR-UHFFFAOYSA-N
Last Updated: 2025-12-30 18:16

Related Q&A

Compound Q&A

What is 7-({(2-Amino-1,3-thiazol-4-yl)[(carboxymethoxy)imino]acetyl}amino)-8-oxo-3-vinyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS: 108691-83-4)?

This compound is a complex organic molecule with a unique structure, including a thiazole ring, a th...

Compound Q&A

Is 7-({(2-Amino-1,3-thiazol-4-yl)[(carboxymethoxy)imino]acetyl}amino)-8-oxo-3-vinyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS: 108691-83-4) safe?

Safety depends on the context of use. This compound is generally safe when handled with appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...