Compound Q&A

What is (1R,3aR,7aR)-1-((2R,5S,E)-6-hydroxy-5,6-dimethylhept-3-en-2-yl)-7a-methylhexahydro-1H-inden-4(2H)-one (CAS: 95716-68-0)?

Answer

(1R,3aR,7aR)-1-((2R,5S,E)-6-hydroxy-5,6-dimethylhept-3-en-2-yl)-7a-methylhexahydro-1H-inden-4(2H)-one
This compound is a chiral sesquiterpene lactone. It has a complex structure with a 1H-indenone ring fused to a hexahydrocyclohexane ring, and exhibits a specific stereochemistry. It is characterized by its hydroxy and methyl substituents on the side chain, and is typically found in natural sources such as plants and fungi. This compound serves as a precursor or intermediate in various chemical syntheses and natural product studies.

About

CAS No 95716-68-0
English Name (1R,3aR,7aR)-1-((2R,5S,E)-6-hydroxy-5,6-dimethylhept-3-en-2-yl)-7a-methylhexahydro-1H-inden-4(2H)-one
Molecular Formula C19H32O2
Molecular Weight 292.46 g/mol
SMILES CC(C=CC(C)C(C)(C)O)C1CCC2C1(CCCC2=O)C
InChIKey QZJWXZGUOIMBAV-WXWTUHQWSA-N
Last Updated: 2025-12-30 09:27

Related Q&A

Compound Q&A

What are the main uses of (1R,3aR,7aR)-1-((2R,5S,E)-6-hydroxy-5,6-dimethylhept-3-en-2-yl)-7a-methylhexahydro-1H-inden-4(2H)-one (CAS: 95716-68-0)?

This compound is primarily used in pharmaceutical and natural product research, acting as a valuable...

Compound Q&A

Is (1R,3aR,7aR)-1-((2R,5S,E)-6-hydroxy-5,6-dimethylhept-3-en-2-yl)-7a-methylhexahydro-1H-inden-4(2H)-one (CAS: 95716-68-0) safe?

The safety of this compound depends on its intended use and application. It is generally safe when h...

Compound Q&A

How should (1R,3aR,7aR)-1-((2R,5S,E)-6-hydroxy-5,6-dimethylhept-3-en-2-yl)-7a-methylhexahydro-1H-inden-4(2H)-one (CAS: 95716-68-0) be stored?

This compound should be stored in a cool, dry place away from direct sunlight and heat sources to pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...