Compound Q&A

Are there alternatives to (6R,7R)-3-(Acetoxymethyl)-7-[(bromoacetyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid in synthesis (CAS: 26973-80-8)?

Answer

(6R,7R)-3-(Acetoxymethyl)-7-[(bromoacetyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
Alternatives include similar bromoacetyl derivatives with different substituents, such as methyl or ethyl groups, which can serve as less reactive analogs in various synthetic pathways. Isomers and related compounds can also be used as substitutes depending on the specific reaction conditions and desired product properties.

About

CAS No 26973-80-8
English Name (6R,7R)-3-(Acetoxymethyl)-7-[(bromoacetyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
Molecular Formula C12H13BrN2O6S
Molecular Weight 393.22 g/mol
SMILES CC(=O)OCC1=C(N2C(C(C2=O)NC(=O)CBr)SC1)C(=O)O
InChIKey VDMWZOLTJWUSJT-LDYMZIIASA-N
Last Updated: 2025-12-30 05:21

Related Q&A

Compound Q&A

What regulatory guidelines apply to (6R,7R)-3-(Acetoxymethyl)-7-[(bromoacetyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS: 26973-80-8)?

This compound is subject to the Globally Harmonized System of Classification and Labelling of Chemic...

Compound Q&A

What is the market or research trend for (6R,7R)-3-(Acetoxymethyl)-7-[(bromoacetyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS: 26973-80-8)?

Research trends indicate growing interest in the development of new antiviral agents and potential p...

Compound Q&A

How should waste containing (6R,7R)-3-(Acetoxymethyl)-7-[(bromoacetyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS: 26973-80-8) be handled?

Waste containing this compound should be collected in appropriate containers and stored in a well-ve...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...