Compound Q&A

Are there alternatives to 2-Methyl-2-propanyl 4-bromo-3-methylbenzoate (CAS: 347174-28-1) in synthesis?

Answer

2-Methyl-2-propanyl 4-bromo-3-methylbenzoate
While 2-Methyl-2-propanyl 4-bromo-3-methylbenzoate (CAS: 347174-28-1) is a specific chemical compound, alternatives such as other brominated benzoates or similar substituted benzoic acid derivatives may be used in synthesis depending on the desired properties. Common alternatives include 3-chloro-4-methylbenzoic acid and 4-bromo-3-methylbenzoic acid, which can serve as effective substitutes in various chemical reactions.

About

English Name 2-Methyl-2-propanyl 4-bromo-3-methylbenzoate
Molecular Formula C12H15BrO2
Molecular Weight 271.15 g/mol
SMILES O=C(c1ccc(c(c1)C)Br)OC(C)(C)C
InChIKey RIHBTHGKWXRWQX-UHFFFAOYSA-N
Last Updated: 2025-12-30 05:21

Related Q&A

Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl 4-bromo-3-methylbenzoate (CAS: 347174-28-1)?

2-Methyl-2-propanyl 4-bromo-3-methylbenzoate (CAS: 347174-28-1) falls under the scope of various reg...

Compound Q&A

What is the market or research trend for 2-Methyl-2-propanyl 4-bromo-3-methylbenzoate (CAS: 347174-28-1)?

The market and research trends for 2-Methyl-2-propanyl 4-bromo-3-methylbenzoate (CAS: 347174-28-1) a...

Compound Q&A

How should waste containing 2-Methyl-2-propanyl 4-bromo-3-methylbenzoate (CAS: 347174-28-1) be handled?

Waste containing 2-Methyl-2-proanyl 4-bromo-3-methylbenzoate (CAS: 347174-28-1) should be managed st...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...