Compound Q&A

Are there alternatives to (3-hydroxy-5-nitro-phenyl)boronic acid (CAS: 737001-07-9) in synthesis?

Answer

(3-hydroxy-5-nitro-phenyl)boronic acid
Yes, there are alternatives to (3-hydroxy-5-nitro-phenyl)boronic acid (CAS: 737001-07-9) in synthesis, such as other boronic acids or boronate esters. These alternatives can provide similar reactivity patterns but may have different functional groups or properties, offering flexibility in chemical synthesis.

About

English Name (3-hydroxy-5-nitro-phenyl)boronic acid
Molecular Formula C6H6BNO5
Molecular Weight 182.93 g/mol
SMILES B(C1=CC(=CC(=C1)O)[N+](=O)[O-])(O)O
InChIKey UWOUWIYCKIKPFP-UHFFFAOYSA-N
Last Updated: 2025-12-30 05:21

Related Q&A

Compound Q&A

What regulatory guidelines apply to (3-hydroxy-5-nitro-phenyl)boronic acid (CAS: 737001-07-9)?

The (3-hydroxy-5-nitro-phenyl)boronic acid (CAS: 737001-07-9) is subject to various regulatory guide...

Compound Q&A

What is the market or research trend for (3-hydroxy-5-nitro-phenyl)boronic acid (CAS: 737001-07-9)?

The market for (3-hydroxy-5-nitro-phenyl)boronic acid (CAS: 737001-07-9) is growing due to its incre...

Compound Q&A

How should waste containing (3-hydroxy-5-nitro-phenyl)boronic acid (CAS: 737001-07-9) be handled?

Waste containing (3-hydroxy-5-nitro-phenyl)boronic acid (CAS: 737001-07-9) should be collected in ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...