Compound Q&A

What regulatory guidelines apply to [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 871332-71-7)?

Answer

[4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid
The [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 871332-71-7) falls under various regulatory frameworks. It is subject to the Globally Harmonized System of Classification and Labeling of Chemicals (GHS) for potential hazards. In the European Union, it is regulated by REACH for chemical registration, evaluation, authorization, and restriction. Additionally, the FDA and EPA have specific requirements for the handling and registration of pharmaceutical and chemical substances, respectively. Compliance with these regulations is essential to ensure safe handling and use.

About

English Name [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid
Molecular Formula C11H13BClNO4
Molecular Weight 269.493 g/mol
SMILES B(C1=CC(=C(C=C1)Cl)C(=O)N2CCOCC2)(O)O
InChIKey SWIHOHJBUZBINE-UHFFFAOYSA-N
Last Updated: 2025-12-30 05:21

Related Q&A

Compound Q&A

Are there alternatives to [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 871332-71-7) in synthesis?

There are several alternatives to [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 87133...

Compound Q&A

What is the market or research trend for [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 871332-71-7)?

The market for [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 871332-71-7) is driven b...

Compound Q&A

How should waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 871332-71-7) be handled?

Waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 871332-71-7) should be...

Compound Q&A

How is [3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 1704069-27-1) typically synthesized?

[3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 170406...

1704069-27-1[3-(1-Pyrrolidinylsu...
Compound Q&A

What industries use 2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5)?

2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5) is used in the pharmace...

55595-54-52-Chlorodibenzo[b,f]...
Compound Q&A

What is 3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane (CAS: 160172-46-3)?

3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane is an organosilico...

160172-46-33-[(Dimethylsilyl)ox...
Compound Q&A

How should waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 871332-71-7) be handled?

Waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 87...

871332-71-7[4-Chloro-3-(4-morph...