Compound Q&A

Are there alternatives to 6-Phosphogluconic acid (CAS: 921-62-0) in synthesis?

Answer

6-Phosphogluconic acid
While 6-Phosphogluconic acid (CAS: 921-62-0) is a specific compound, there are alternative reagents and molecules used in its synthesis. For example, glucose-6-phosphate can be used as a precursor, and enzymes such as glucose-6-phosphate dehydrogenase can catalyze the formation of 6-Phosphogluconic acid. Other alternatives include using isomers like 6-deoxygluconic acid or other related sugars. These alternatives may offer different reactivity profiles and can be selected based on the specific requirements of the synthesis.

About

CAS No 921-62-0
English Name 6-Phosphogluconic acid
Molecular Formula C6H13O10P
Molecular Weight 276.13 g/mol
SMILES C(C(C(C(C(C(=O)O)O)O)O)O)OP(=O)(O)O
InChIKey BIRSGZKFKXLSJQ-UHFFFAOYSA-N
Last Updated: 2025-12-29 16:50

Related Q&A

Compound Q&A

What regulatory guidelines apply to 6-Phosphogluconic acid (CAS: 921-62-0)?

6-Phosphogluconic acid (CAS: 921-62-0) falls under the scope of various regulatory guidelines. It is...

Compound Q&A

What is the market or research trend for 6-Phosphogluconic acid (CAS: 921-62-0)?

The market for 6-Phosphogluconic acid (CAS: 921-62-0) is driven by its applications in biotechnology...

Compound Q&A

How should waste containing 6-Phosphogluconic acid (CAS: 921-62-0) be handled?

Handling waste containing 6-Phosphogluconic acid (CAS: 921-62-0) involves ensuring compliance with l...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...