Compound Q&A

What is the market or research trend for (S)-Alpha-(fmoc-amino)-cyclobutaneacetic acid?

Answer

(S)-Alpha-(fmoc-amino)-cyclobutaneacetic acid
The market and research trend for (S)-Alpha-(fmoc-amino)-cyclobutaneacetic acid is growing due to its applications in medicinal chemistry and peptide synthesis. Its use in developing new drugs and therapeutic peptides is increasing, driven by the need for specific stereochemistry control and functional groups. Research is also focusing on its role in drug discovery and development.

About

English Name (S)-Alpha-(fmoc-amino)-cyclobutaneacetic acid
Molecular Formula C21H21NO4
Molecular Weight 351.4 g/mol
SMILES O=C(N[C@@H](C1CCC1)C(=O)O)OCC1c2ccccc2c2c1cccc2
InChIKey TXLUWFPQLXODBP-IBGZPJMESA-N
Last Updated: 2025-12-29 16:50

Related Q&A

Compound Q&A

What regulatory guidelines apply to (S)-Alpha-(fmoc-amino)-cyclobutaneacetic acid (CAS: 1391630-31-1)?

The (S)-Alpha-(fmoc-amino)-cyclobutaneacetic acid (CAS: 1391630-31-1) is subject to various regulato...

Compound Q&A

Are there alternatives to (S)-Alpha-(fmoc-amino)-cyclobutaneacetic acid in synthesis?

Yes, there are alternatives to (S)-Alpha-(fmoc-amino)-cyclobutaneacetic acid in synthesis, such as o...

Compound Q&A

How should waste containing (S)-Alpha-(fmoc-amino)-cyclobutaneacetic acid be handled?

Waste containing (S)-Alpha-(fmoc-amino)-cyclobutaneacetic acid (CAS: 1391630-31-1) should be collect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...