Compound Q&A

Are there alternatives to Phenethylmagnesium chloride (CAS: 90878-19-6) in synthesis?

Answer

Phenethylmagnesium chloride
Alternatives to Phenethylmagnesium chloride (CAS: 90878-19-6) include other organomagnesium compounds like phenethylmagnesium bromide or tributyl magnesium, which can serve similar functions in organic synthesis. Additionally, nucleophilic substitution reagents such as Grignard reagents or organolithium reagents can be viable substitutes depending on the specific reaction conditions and desired products.

About

CAS No 90878-19-6
English Name Phenethylmagnesium chloride
Molecular Formula C8H9ClMg
Molecular Weight 164.92 g/mol
SMILES [CH2-]CC1=CC=CC=C1.[Mg+2].[Cl-]
InChIKey AZORNQXQALOFHH-UHFFFAOYSA-M
Last Updated: 2025-12-29 11:34

Related Q&A

Compound Q&A

What regulatory guidelines apply to Phenethylmagnesium chloride (CAS: 90878-19-6)?

Phenethylmagnesium chloride (CAS: 90878-19-6) is classified as a flammable liquid under the Globally...

Compound Q&A

What is the market or research trend for Phenethylmagnesium chloride (CAS: 90878-19-6)?

Phenethylmagnesium chloride (CAS: 90878-19-6) remains a significant reagent in the synthesis of vari...

Compound Q&A

How should waste containing Phenethylmagnesium chloride (CAS: 90878-19-6) be handled?

Waste containing Phenethylmagnesium chloride (CAS: 90878-19-6) should be handled by first neutralizi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...