Compound Q&A

What industries use 1,1'-(1,3-Phenylene)bis(1H-1,2,4-triazole) (CAS: 514222-44-7)?

Answer

1,1'-(1,3-Phenylene)bis(1H-1,2,4-triazole)
1,1'-(1,3-Phenylene)bis(1H-1,2,4-triazole) is utilized in various industries including pharmaceuticals for its antimicrobial properties, polymers for its reinforcing and functionalizing capabilities, sensors for detection of specific gases, and semiconductors for its use in electronic devices due to its excellent thermal and electrical conductivity.

About

English Name 1,1'-(1,3-Phenylene)bis(1H-1,2,4-triazole)
Molecular Formula C10H8N6
Molecular Weight 212.22 g/mol
SMILES c1cc(cc(c1)n2cncn2)n3cncn3
InChIKey WXNXRKYXCCDJHI-UHFFFAOYSA-N
Last Updated: 2025-12-29 01:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,1'-(1,3-Phenylene)bis(1H-1,2,4-triazole) (CAS: 514222-44-7)?

1,1'-(1,3-Phenylene)bis(1H-1,2,4-triazole) is a crystalline solid with a molecular weight of approxi...

Compound Q&A

How is 1,1'-(1,3-Phenylene)bis(1H-1,2,4-triazole) (CAS: 514222-44-7) typically synthesized?

1,1'-(1,3-Phenylene)bis(1H-1,2,4-triazole) is commonly synthesized via a multistep process involving...

Compound Q&A

What precautions should be taken when handling 1,1'-(1,3-Phenylene)bis(1H-1,2,4-triazole) (CAS: 514222-44-7)?

When handling 1,1'-(1,3-Phenylene)bis(1H-1,2,4-triazole), it is important to use personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...