Compound Q&A

What are the physical and chemical properties of Tert-butyl 2,2-dimethyl-3-oxopiperazine-1-carboxylate (CAS: 1104383-06-3)?

Answer

Tert-butyl 2,2-dimethyl-3-oxopiperazine-1-carboxylate
Tert-butyl 2,2-dimethyl-3-oxopiperazine-1-carboxylate is a white crystalline solid with a molecular weight of approximately 266.38 g/mol. It is soluble in organic solvents like dichloromethane and acetone but has low water solubility. This compound is known for its stability under normal conditions and exhibits moderate reactivity towards nucleophiles. It is often used in organic synthesis and pharmaceutical applications.

About

English Name Tert-butyl 2,2-dimethyl-3-oxopiperazine-1-carboxylate
Molecular Formula C11H20N2O3
Molecular Weight 228.29 g/mol
SMILES CC1(C(=O)NCCN1C(=O)OC(C)(C)C)C
InChIKey ADXBXIQTAQOYRW-UHFFFAOYSA-N
Last Updated: 2025-12-29 01:16

Related Q&A

Compound Q&A

How is Tert-butyl 2,2-dimethyl-3-oxopiperazine-1-carboxylate (CAS: 1104383-06-3) typically synthesized?

Tert-butyl 2,2-dimethyl-3-oxopiperazine-1-carboxylate can be synthesized via a multi-step process in...

Compound Q&A

What industries use Tert-butyl 2,2-dimethyl-3-oxopiperazine-1-carboxylate (CAS: 1104383-06-3)?

Tert-butyl 2,2-dimethyl-3-oxopiperazine-1-carboxylate is primarily used in the pharmaceutical and ch...

Compound Q&A

What precautions should be taken when handling Tert-butyl 2,2-dimethyl-3-oxopiperazine-1-carboxylate (CAS: 1104383-06-3)?

When handling Tert-butyl 2,2-dimethyl-3-oxopiperazine-1-carboxylate, it is important to wear appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...