Compound Q&A

What precautions should be taken when handling Pyridoxine alpha-Ketoglutarate (CAS: 27280-85-9)?

Answer

Pyridoxine alpha-Ketoglutarate
When handling Pyridoxine alpha-Ketoglutarate (CAS: 27280-85-9), ensure the use of appropriate personal protective equipment (PPE) such as gloves and safety goggles. Work should be conducted in a well-ventilated area or fume hood. Spills should be cleaned up using appropriate methods, and the material safety data sheet (MSDS/SDS) should be consulted for detailed safety instructions.

About

CAS No 27280-85-9
English Name Pyridoxine alpha-Ketoglutarate
Molecular Formula C13H17NO8
Molecular Weight 315.28 g/mol
SMILES CC1=NC=C(C(=C1O)CO)CO.C(CC(=O)O)C(=O)C(=O)O
InChIKey MLAUVUHGQARGDU-UHFFFAOYSA-N
Last Updated: 2025-12-29 01:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of Pyridoxine alpha-Ketoglutarate (CAS: 27280-85-9)?

Pyridoxine alpha-Ketoglutarate (CAS: 27280-85-9) is a crystalline compound with a molecular weight o...

Compound Q&A

How is Pyridoxine alpha-Ketoglutarate (CAS: 27280-85-9) typically synthesized?

Pyridoxine alpha-Ketoglutarate is typically synthesized through a multi-step process involving the c...

Compound Q&A

What industries use Pyridoxine alpha-Ketoglutarate (CAS: 27280-85-9)?

Pyridoxine alpha-Ketoglutarate is primarily used in the pharmaceutical industry as an intermediate i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...