Compound Q&A

What industries use Methyl 3-amino-5-ethoxybenzoate (CAS: 706792-04-3)?

Answer

Methyl 3-amino-5-ethoxybenzoate
Methyl 3-amino-5-ethoxybenzoate is used in the pharmaceutical industry for the synthesis of certain drugs. It is also utilized in the polymer industry as a monomer and in the sensor industry for its electrochemical properties. Additionally, it has applications in semiconductor manufacturing due to its reactivity and stability.

About

English Name Methyl 3-amino-5-ethoxybenzoate
Molecular Formula C10H13NO3
Molecular Weight 195.22 g/mol
SMILES CCOC1=CC(=CC(=C1)N)C(=O)OC
InChIKey UBCBLDVGUKBPKU-UHFFFAOYSA-N
Last Updated: 2025-12-28 19:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 3-amino-5-ethoxybenzoate (CAS: 706792-04-3)?

Methyl 3-amino-5-ethoxybenzoate has a crystalline form. Its molecular weight is approximately 220.28...

Compound Q&A

How is Methyl 3-amino-5-ethoxybenzoate (CAS: 706792-04-3) typically synthesized?

Methyl 3-amino-5-ethoxybenzoate is typically synthesized by the reaction of 3-amino-5-ethoxybenzoic ...

Compound Q&A

What precautions should be taken when handling Methyl 3-amino-5-ethoxybenzoate (CAS: 706792-04-3)?

When handling Methyl 3-amino-5-ethoxybenzoate, it is important to wear appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...