Compound Q&A

What are the physical and chemical properties of 1,8-Naphthyridine-4-carboxylic acid (CAS: 99066-71-4)?

Answer

1,8-Naphthyridine-4-carboxylic acid
1,8-Naphthyridine-4-carboxylic acid is a crystalline solid with a molecular weight of approximately 165.15 g/mol. It has a high solubility in water and organic solvents. This compound is moderately reactive, particularly towards nucleophilic substitution reactions. It is often used in organic synthesis and pharmaceutical applications due to its structural properties.

About

CAS No 99066-71-4
English Name 1,8-Naphthyridine-4-carboxylic acid
Molecular Formula C9H6N2O2
Molecular Weight 174.16 g/mol
SMILES C1=CC2=C(C=CN=C2N=C1)C(=O)O
InChIKey OHLKQPVOQXXCDW-UHFFFAOYSA-N
Last Updated: 2025-12-28 19:55

Related Q&A

Compound Q&A

How is 1,8-Naphthyridine-4-carboxylic acid (CAS: 99066-71-4) typically synthesized?

1,8-Naphthyridine-4-carboxylic acid is commonly synthesized via the condensation of 1,8-naphthyridin...

Compound Q&A

What industries use 1,8-Naphthyridine-4-carboxylic acid (CAS: 99066-71-4)?

1,8-Naphthyridine-4-carboxylic acid is used in various industries, including pharmaceuticals, where ...

Compound Q&A

What precautions should be taken when handling 1,8-Naphthyridine-4-carboxylic acid (CAS: 99066-71-4)?

When handling 1,8-Naphthyridine-4-carboxylic acid, it is important to use personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...