Compound Q&A

How is safflor yellow (A) (CAS: 85532-77-0) typically synthesized?

Answer

safflor yellow (A)
Safflor yellow (A) (CAS: 85532-77-0) is typically synthesized through a multistep process involving the condensation of coumarin with a reducing agent. The reaction is catalyzed by various acids, with selectivity and yield varying depending on the specific conditions and catalyst used.

About

CAS No 85532-77-0
English Name safflor yellow (A)
Molecular Formula C27H30O16
Molecular Weight 610.52 g/mol
SMILES OCC1OC2C(C(C1O)O)OC1=C2C(=C(C(=O)C=Cc2ccc(cc2)O)C(=O)C1(O)OC1OC(CO)C(C(C1O)O)O)O
InChIKey AQMZAOSKHKZGNI-UHFFFAOYSA-N
Last Updated: 2025-12-28 19:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of safflor yellow (A) (CAS: 85532-77-0)?

Safflor yellow (A) (CAS: 85532-77-0) is a crystalline compound with a molecular weight of approximat...

Compound Q&A

What industries use safflor yellow (A) (CAS: 85532-77-0)?

Safflor yellow (A) (CAS: 85532-77-0) is used in the pharmaceutical industry for its antioxidant and ...

Compound Q&A

What precautions should be taken when handling safflor yellow (A) (CAS: 85532-77-0)?

When handling safflor yellow (A) (CAS: 85532-77-0), wear appropriate personal protective equipment (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...