Compound Q&A

What are the physical and chemical properties of 3-Methoxy-4-nitrobenzonitrile (CAS: 177476-75-4)?

Answer

3-Methoxy-4-nitrobenzonitrile
3-Methoxy-4-nitrobenzonitrile is a crystalline solid with a molecular weight of approximately 217.14 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. The compound is moderately reactive, showing electrophilic aromatic substitution reactivity. It exists as a crystalline solid at room temperature and has a melting point of around 125-126°C.

About

English Name 3-Methoxy-4-nitrobenzonitrile
Molecular Formula C8H6N2O3
Molecular Weight 178.14 g/mol
SMILES COC1=C(C=CC(=C1)C#N)[N+](=O)[O-]
InChIKey LCBUSDDLYBHQFA-UHFFFAOYSA-N
Last Updated: 2025-12-28 14:56

Related Q&A

Compound Q&A

How is 3-Methoxy-4-nitrobenzonitrile (CAS: 177476-75-4) typically synthesized?

3-Methoxy-4-nitrobenzonitrile can be synthesized via the nitration of 3-methoxybenzonitrile followed...

Compound Q&A

What industries use 3-Methoxy-4-nitrobenzonitrile (CAS: 177476-75-4)?

3-Methoxy-4-nitrobenzonitrile is used in various industries, including pharmaceuticals for the synth...

Compound Q&A

What precautions should be taken when handling 3-Methoxy-4-nitrobenzonitrile (CAS: 177476-75-4)?

When handling 3-Methoxy-4-nitrobenzonitrile, it is important to wear appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...