Compound Q&A

What precautions should be taken when handling 3-Bromo-5-chloro-2-(trifluoromethyl)pyridine (CAS: 823222-22-6)?

Answer

3-Bromo-5-chloro-2-(trifluoromethyl)pyridine
When handling 3-Bromo-5-chloro-2-(trifluoromethyl)pyridine, it is crucial to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The substance should be stored in a cool, dry place and handled in a well-ventilated area or a fume hood to minimize inhalation risks. In case of a spill, immediately clean it up according to the safety data sheet (SDS) guidelines and dispose of it properly. Always consult the SDS for detailed safety information.

About

English Name 3-Bromo-5-chloro-2-(trifluoromethyl)pyridine
Molecular Formula C6H2BrClF3N
Molecular Weight 260.44 g/mol
SMILES C1=C(C=NC(=C1Br)C(F)(F)F)Cl
InChIKey BWXSEIVHZVWQFZ-UHFFFAOYSA-N
Last Updated: 2025-12-28 14:56

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Bromo-5-chloro-2-(trifluoromethyl)pyridine (CAS: 823222-22-6)?

3-Bromo-5-chloro-2-(trifluoromethyl)pyridine is a crystalline solid with a molecular weight of appro...

Compound Q&A

How is 3-Bromo-5-chloro-2-(trifluoromethyl)pyridine (CAS: 823222-22-6) typically synthesized?

3-Bromo-5-chloro-2-(trifluoromethyl)pyridine is typically synthesized via electrophilic aromatic sub...

Compound Q&A

What industries use 3-Bromo-5-chloro-2-(trifluoromethyl)pyridine (CAS: 823222-22-6)?

3-Bromo-5-chloro-2-(trifluoromethyl)pyridine finds applications in the pharmaceutical and chemical i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...