Compound Q&A

What are the physical and chemical properties of β-nicotinamide mononucleotide, reduced form, disodium salt (CAS: 108347-85-9)?

Answer

β-nicotinamide mononucleotide, reduced form, disodium salt
β-nicotinamide mononucleotide, reduced form, disodium salt is a white or off-white crystalline solid. Its molecular weight is approximately 344.15 g/mol. It is soluble in water and slightly soluble in ethanol. This compound is relatively stable but can be sensitive to light and air exposure. It is used in various biochemical and pharmaceutical applications due to its nucleotide structure.

About

English Name β-nicotinamide mononucleotide, reduced form, disodium salt
Molecular Formula C11H18N2NaO8P
Molecular Weight 360.23 g/mol
SMILES O[C@@H]1[C@@H]([C@@H](COP(O)(O)=O)O[C@H]1N1C=CCC(C(=O)N)=C1)O.[NaH]
InChIKey LSKSZICSFLRXJW-BXMOOSBBSA-N
Last Updated: 2025-12-28 14:56

Related Q&A

Compound Q&A

How is β-nicotinamide mononucleotide, reduced form, disodium salt (CAS: 108347-85-9) typically synthesized?

β-nicotinamide mononucleotide, reduced form, disodium salt is typically synthesized by the reduction...

Compound Q&A

What industries use β-nicotinamide mononucleotide, reduced form, disodium salt (CAS: 108347-85-9)?

β-nicotinamide mononucleotide, reduced form, disodium salt is primarily used in the pharmaceutical i...

Compound Q&A

What precautions should be taken when handling β-nicotinamide mononucleotide, reduced form, disodium salt (CAS: 108347-85-9)?

When handling β-nicotinamide mononucleotide, reduced form, disodium salt, it is important to wear pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...