Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 3-bromo-4-oxo-1-pyrrolidinecarboxylate (CAS: 885278-03-5)?

Answer

2-Methyl-2-propanyl 3-bromo-4-oxo-1-pyrrolidinecarboxylate
2-Methyl-2-propanyl 3-bromo-4-oxo-1-pyrrolidinecarboxylate (CAS: 885278-03-5) is a crystalline solid with a molecular weight of approximately 232.04 g/mol. It has a low solubility in water but is soluble in organic solvents such as dichloromethane and acetone. This compound is highly reactive, particularly towards nucleophilic substitution reactions. It is stable under normal conditions but should be stored in a cool, dry place away from moisture and strong acids.

About

English Name 2-Methyl-2-propanyl 3-bromo-4-oxo-1-pyrrolidinecarboxylate
Molecular Formula C9H14BrNO3
Molecular Weight 264.11899999999997 g/mol
SMILES CC(C)(C)OC(=O)N1CC(C(=O)C1)Br
InChIKey JLGDEUGSXALHGU-UHFFFAOYSA-N
Last Updated: 2025-12-28 10:59

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 3-bromo-4-oxo-1-pyrrolidinecarboxylate (CAS: 885278-03-5) typically synthesized?

2-Methyl-2-propanyl 3-bromo-4-oxo-1-pyrrolidinecarboxylate is synthesized via the bromination of 2-m...

Compound Q&A

What industries use 2-Methyl-2-propanyl 3-bromo-4-oxo-1-pyrrolidinecarboxylate (CAS: 885278-03-5)?

2-Methyl-2-propanyl 3-bromo-4-oxo-1-pyrrolidinecarboxylate (CAS: 885278-03-5) is primarily used in t...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 3-bromo-4-oxo-1-pyrrolidinecarboxylate (CAS: 885278-03-5)?

When handling 2-Methyl-2-propanyl 3-bromo-4-oxo-1-pyrrolidinecarboxylate (CAS: 885278-03-5), it is i...

Compound Q&A

Is 4-Anilino-1H-1,2,3-triazole-5-carboxylic acid (CAS: 72693-60-8) safe?

4-Anilino-1H-1,2,3-triazole-5-carboxylic acid is generally considered safe when ...

72693-60-84-Anilino-1H-1,2,3-t...
Compound Q&A

How should waste containing 2-(2-Aminoethyl)-1H-benzimidazol-4-ol (CAS: 933697-27-9) be handled?

Waste containing 2-(2-Aminoethyl)-1H-benzimidazol-4-ol (CAS: 933697-27-9) should...

933697-27-92-(2-Aminoethyl)-1H-...
Compound Q&A

How is 4-Amino-5-chloro-N-[2-(diethylamino)ethyl]-2-hydroxybenzamide hydrochloride (CAS: 38059-78-8) typically synthesized?

4-Amino-5-chloro-N-[2-(diethylamino)ethyl]-2-hydroxybenzamide hydrochloride is t...

38059-78-84-Amino-5-chloro-N-[...
Compound Q&A

What are the main uses of 2-(4-Bromophenyl)-1-(2,4-dihydroxyphenyl)ethanone (CAS: 92152-60-8)?

2-(4-Bromophenyl)-1-(2,4-dihydroxyphenyl)ethanone (CAS: 92152-60-8) is primarily...

92152-60-82-(4-Bromophenyl)-1-...