Compound Q&A

What are the physical and chemical properties of 4-Acetyl-1,3-benzoxazol-2(3H)-one (CAS: 70735-79-4)?

Answer

4-Acetyl-1,3-benzoxazol-2(3H)-one
4-Acetyl-1,3-benzoxazol-2(3H)-one is a crystalline solid with a molecular weight of approximately 211.23 g/mol. It is slightly soluble in water and has good solubility in organic solvents like ethanol and acetone. This compound is relatively stable under normal conditions but can be susceptible to oxidation in air. It is known for its reactivity towards nucleophiles and can undergo various transformations in chemical reactions.

About

CAS No 70735-79-4
English Name 4-Acetyl-1,3-benzoxazol-2(3H)-one
Molecular Formula C9H7NO3
Molecular Weight 177.16 g/mol
SMILES CC(=O)C1=C2C(=CC=C1)OC(=O)N2
InChIKey FZAQRVWPQCXSPC-UHFFFAOYSA-N
Last Updated: 2025-12-28 10:59

Related Q&A

Compound Q&A

How is 4-Acetyl-1,3-benzoxazol-2(3H)-one (CAS: 70735-79-4) typically synthesized?

4-Acetyl-1,3-benzoxazol-2(3H)-one can be synthesized via condensation reactions. One common method i...

Compound Q&A

What industries use 4-Acetyl-1,3-benzoxazol-2(3H)-one (CAS: 70735-79-4)?

4-Acetyl-1,3-benzoxazol-2(3H)-one finds applications in various industries. It is used in the pharma...

Compound Q&A

What precautions should be taken when handling 4-Acetyl-1,3-benzoxazol-2(3H)-one (CAS: 70735-79-4)?

When handling 4-Acetyl-1,3-benzoxazol-2(3H)-one, it is essential to use appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...