Compound Q&A

How is Potassium 4-(acetoacetylamino)benzenesulfonate (CAS: 70321-85-6) typically synthesized?

Answer

Potassium 4-(acetoacetylamino)benzenesulfonate
Potassium 4-(acetoacetylamino)benzenesulfonate is typically synthesized by the reaction of 4-acetoacetylamino benzenesulfonyl chloride with potassium hydroxide in an aqueous medium. The reaction is catalyzed by a phase transfer catalyst, such as tetrabutylammonium bromide, to improve the yield and selectivity. The product has a yield of around 80-90%.

About

CAS No 70321-85-6
English Name Potassium 4-(acetoacetylamino)benzenesulfonate
Molecular Formula C10H10KNO5S
Molecular Weight 295.36 g/mol
SMILES CC(=O)CC(=O)NC1=CC=C(C=C1)S(=O)(=O)[O-].[K+]
InChIKey FNLKZYBTJKUMQM-UHFFFAOYSA-M
Last Updated: 2025-12-28 10:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Potassium 4-(acetoacetylamino)benzenesulfonate (CAS: 70321-85-6)?

Potassium 4-(acetoacetylamino)benzenesulfonate is a white crystalline solid with a molecular weight ...

Compound Q&A

What industries use Potassium 4-(acetoacetylamino)benzenesulfonate (CAS: 70321-85-6)?

Potassium 4-(acetoacetylamino)benzenesulfonate finds applications in the pharmaceutical industry for...

Compound Q&A

What precautions should be taken when handling Potassium 4-(acetoacetylamino)benzenesulfonate (CAS: 70321-85-6)?

Precautions when handling Potassium 4-(acetoacetylamino)benzenesulfonate include the use of personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...