Compound Q&A

What are the physical and chemical properties of 2,2,2-Trifluoroethyl 1,1,2,2,3,3,4,4,4-nonafluoro-1-butanesulfonate (CAS: 79963-95-4)?

Answer

2,2,2-Trifluoroethyl 1,1,2,2,3,3,4,4,4-nonafluoro-1-butanesulfonate
2,2,2-Trifluoroethyl 1,1,2,2,3,3,4,4,4-nonafluoro-1-butanesulfonate (CAS: 79963-95-4) is a colorless, highly fluorinated compound. It has a high molecular weight and low solubility in water but is soluble in common organic solvents. The compound is moderately reactive, showing some reactivity towards nucleophiles. It crystallizes in a prismatic form at room temperature.

About

CAS No 79963-95-4
English Name 2,2,2-Trifluoroethyl 1,1,2,2,3,3,4,4,4-nonafluoro-1-butanesulfonate
Molecular Formula C6H2F12O3S
Molecular Weight 382.12 g/mol
SMILES C(C(F)(F)F)OS(=O)(=O)C(C(C(C(F)(F)F)(F)F)(F)F)(F)F
InChIKey KJGYBFLEIPDFNQ-UHFFFAOYSA-N
Last Updated: 2025-12-28 06:21

Related Q&A

Compound Q&A

How is 2,2,2-Trifluoroethyl 1,1,2,2,3,3,4,4,4-nonafluoro-1-butanesulfonate (CAS: 79963-95-4) typically synthesized?

2,2,2-Trifluoroethyl 1,1,2,2,3,3,4,4,4-nonafluoro-1-butanesulfonate is typically synthesized through...

Compound Q&A

What industries use 2,2,2-Trifluoroethyl 1,1,2,2,3,3,4,4,4-nonafluoro-1-butanesulfonate (CAS: 79963-95-4)?

2,2,2-Trifluoroethyl 1,1,2,2,3,3,4,4,4-nonafluoro-1-butanesulfonate (CAS: 79963-95-4) is used in var...

Compound Q&A

What precautions should be taken when handling 2,2,2-Trifluoroethyl 1,1,2,2,3,3,4,4,4-nonafluoro-1-butanesulfonate (CAS: 79963-95-4)?

When handling 2,2,2-Trifluoroethyl 1,1,2,2,3,3,4,4,4-nonafluoro-1-butanesulfonate (CAS: 79963-95-4),...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...