Compound Q&A

What industries use 3-Amino-4-chloro-N-(2-furylmethyl)benzamide (CAS: 852839-94-2)?

Answer

3-Amino-4-chloro-N-(2-furylmethyl)benzamide
3-Amino-4-chloro-N-(2-furylmethyl)benzamide is primarily used in the pharmaceutical industry as an intermediate in the synthesis of drugs. It also finds applications in the polymer industry for its chemical reactivity and in the development of sensors due to its specific functional groups. Additionally, it may be used in the semiconductor industry for specialized applications requiring specific chemical properties.

About

English Name 3-Amino-4-chloro-N-(2-furylmethyl)benzamide
Molecular Formula C12H11ClN2O2
Molecular Weight 250.685 g/mol
SMILES c1cc(oc1)CNC(=O)c2ccc(c(c2)N)Cl
InChIKey RPJRPRMXOSCORN-UHFFFAOYSA-N
Last Updated: 2025-12-28 06:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Amino-4-chloro-N-(2-furylmethyl)benzamide (CAS: 852839-94-2)?

3-Amino-4-chloro-N-(2-furylmethyl)benzamide is a crystalline compound with a molecular weight of app...

Compound Q&A

How is 3-Amino-4-chloro-N-(2-furylmethyl)benzamide (CAS: 852839-94-2) typically synthesized?

3-Amino-4-chloro-N-(2-furylmethyl)benzamide is commonly synthesized via the condensation of 4-chloro...

Compound Q&A

What precautions should be taken when handling 3-Amino-4-chloro-N-(2-furylmethyl)benzamide (CAS: 852839-94-2)?

When handling 3-Amino-4-chloro-N-(2-furylmethyl)benzamide, it is essential to use personal protectiv...

Compound Q&A

Is 1-[(4-Bromophenyl)sulfonyl]azetidine (CAS: 530081-57-3) safe?

The safety of 1-[(4-Bromophenyl)sulfonyl]azetidine (CAS: 530081-57-3) depends on...

530081-57-31-[(4-Bromophenyl)su...
Compound Q&A

What are the physical and chemical properties of 1-N,3-N-diphenylbenzene-1,3-diamine (CAS: 5905-36-2)?

1-N,3-N-diphenylbenzene-1,3-diamine (CAS: 5905-36-2) is a solid with a crystalli...

5905-36-21-N,3-N-diphenylbenz...
Compound Q&A

Is 2-Methyl-2-nitropropane (CAS: 594-70-7) safe?

2-Methyl-2-nitropropane is generally safe when handled with appropriate precauti...

594-70-72-Methyl-2-nitroprop...
Compound Q&A

How should waste containing 1-(2,3-Difluoro-6-methoxyphenyl)methanamine (CAS: 886501-77-5) be handled?

Waste containing 1-(2,3-Difluoro-6-methoxyphenyl)methanamine (CAS: 886501-77-5) ...

886501-77-51-(2,3-Difluoro-6-me...