Compound Q&A

How is 3-Amino-4-chloro-N-(2-furylmethyl)benzamide (CAS: 852839-94-2) typically synthesized?

Answer

3-Amino-4-chloro-N-(2-furylmethyl)benzamide
3-Amino-4-chloro-N-(2-furylmethyl)benzamide is commonly synthesized via the condensation of 4-chloro-3-nitrobenzoic acid with 2-furylmethylamine, followed by reduction of the nitro group to an amino group. The reaction typically involves the use of a reducing agent like sodium borohydride and a catalyst such as sodium hydroxide. The yield is around 75-80% with good selectivity for the desired product.

About

English Name 3-Amino-4-chloro-N-(2-furylmethyl)benzamide
Molecular Formula C12H11ClN2O2
Molecular Weight 250.685 g/mol
SMILES c1cc(oc1)CNC(=O)c2ccc(c(c2)N)Cl
InChIKey RPJRPRMXOSCORN-UHFFFAOYSA-N
Last Updated: 2025-12-28 06:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Amino-4-chloro-N-(2-furylmethyl)benzamide (CAS: 852839-94-2)?

3-Amino-4-chloro-N-(2-furylmethyl)benzamide is a crystalline compound with a molecular weight of app...

Compound Q&A

What industries use 3-Amino-4-chloro-N-(2-furylmethyl)benzamide (CAS: 852839-94-2)?

3-Amino-4-chloro-N-(2-furylmethyl)benzamide is primarily used in the pharmaceutical industry as an i...

Compound Q&A

What precautions should be taken when handling 3-Amino-4-chloro-N-(2-furylmethyl)benzamide (CAS: 852839-94-2)?

When handling 3-Amino-4-chloro-N-(2-furylmethyl)benzamide, it is essential to use personal protectiv...

Compound Q&A

Is 1-[(4-Bromophenyl)sulfonyl]azetidine (CAS: 530081-57-3) safe?

The safety of 1-[(4-Bromophenyl)sulfonyl]azetidine (CAS: 530081-57-3) depends on...

530081-57-31-[(4-Bromophenyl)su...
Compound Q&A

What are the physical and chemical properties of 1-N,3-N-diphenylbenzene-1,3-diamine (CAS: 5905-36-2)?

1-N,3-N-diphenylbenzene-1,3-diamine (CAS: 5905-36-2) is a solid with a crystalli...

5905-36-21-N,3-N-diphenylbenz...
Compound Q&A

Is 2-Methyl-2-nitropropane (CAS: 594-70-7) safe?

2-Methyl-2-nitropropane is generally safe when handled with appropriate precauti...

594-70-72-Methyl-2-nitroprop...
Compound Q&A

How should waste containing 1-(2,3-Difluoro-6-methoxyphenyl)methanamine (CAS: 886501-77-5) be handled?

Waste containing 1-(2,3-Difluoro-6-methoxyphenyl)methanamine (CAS: 886501-77-5) ...

886501-77-51-(2,3-Difluoro-6-me...