Compound Q&A

What is Caspofungin Impurity A (CAS: 1202167-57-4)?

Answer

Caspofungin Impurity A
Caspofungin Impurity A is a critical intermediate used in the synthesis of caspofungin, a potent antifungal medication. It does not have a specific chemical formula but is known to be a byproduct with specific impurity profiles.

About

English Name Caspofungin Impurity A
Molecular Formula C51H86N10O15
Molecular Weight 1079.29 g/mol
SMILES O[C@H]1CCN2C([C@H]([C@@H](CCN)O)NC([C@H]([C@@H]([C@H](C3C=CC(=CC=3)O)O)O)NC([C@@H]3C[C@H](CN3C([C@H](CO)NC([C@H](C[C@H]([C@@H](NCCN)NC([C@@H]21)=O)O)NC(CCCCCCCCC(C)CC(C)CC)=O)=O)=O)O)=O)=O)=O
InChIKey GINOBWNPZWJLMW-KYODTCIHSA-N
Last Updated: 2025-12-28 00:35

Related Q&A

Compound Q&A

What are the main uses of Caspofungin Impurity A (CAS: 1202167-57-4)?

Caspofungin Impurity A is primarily used in the pharmaceutical industry as an intermediate for the s...

Compound Q&A

Is Caspofungin Impurity A (CAS: 1202167-57-4) safe?

Caspofungin Impurity A is generally considered safe when handled with appropriate precautions. It is...

Compound Q&A

How should Caspofungin Impurity A (CAS: 1202167-57-4) be stored?

Caspofungin Impurity A should be stored in a cool, dry place at a temperature not exceeding 25°C, aw...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...