Compound Q&A

What is Ampicillin EP Impurity B (CAS: 19379-33-0)?

Answer

Ampicillin EP Impurity B (L-Ampicillin)
Ampicillin EP Impurity B, also known as L-Ampicillin, is a byproduct of the synthesis of ampicillin. It is an amide derivative of penicillin and has a molecular formula of C16H17N3O5S. This compound is characterized by its antibacterial properties, although it is less effective than its parent compound ampicillin.

About

CAS No 19379-33-0
English Name Ampicillin EP Impurity B (L-Ampicillin)
Molecular Formula C16H19N3O4S
Molecular Weight 349.41 g/mol
SMILES CC1(C(N2C(S1)C(C2=O)NC(=O)C(C3=CC=CC=C3)N)C(=O)O)C
InChIKey AVKUERGKIZMTKX-BBGACYKPSA-N
Last Updated: 2025-12-27 21:14

Related Q&A

Compound Q&A

What are the main uses of Ampicillin EP Impurity B (CAS: 19379-33-0)?

Ampicillin EP Impurity B is mainly used as a reference material in quality control and impurity test...

Compound Q&A

Is Ampicillin EP Impurity B (CAS: 19379-33-0) safe?

Ampicillin EP Impurity B (L-Ampicillin) is generally considered safe when handled properly. However,...

Compound Q&A

How should Ampicillin EP Impurity B (CAS: 19379-33-0) be stored?

Ampicillin EP Impurity B should be stored in a tightly sealed container at a temperature below 25°C ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...