Compound Q&A

What is Ethyl 2-phenyl-1,3-thiazole-4-carboxylate (CAS: 59937-01-8)?

Answer

Ethyl 2-phenyl-1,3-thiazole-4-carboxylate
Ethyl 2-phenyl-1,3-thiazole-4-carboxylate (CAS: 59937-01-8) is an organic compound with the molecular formula C13H12N2O2S. It is a derivative of thiazole containing an ethyl ester group and a phenyl ring. This compound is known for its unique chemical properties and has potential applications in various fields such as pharmaceuticals and research.

About

CAS No 59937-01-8
English Name Ethyl 2-phenyl-1,3-thiazole-4-carboxylate
Molecular Formula C12H11NO2S
Molecular Weight 233.29 g/mol
SMILES CCOC(=O)C1=CSC(=N1)C2=CC=CC=C2
InChIKey UKKGDCGESAFSJY-UHFFFAOYSA-N
Last Updated: 2025-12-27 21:14

Related Q&A

Compound Q&A

What are the main uses of Ethyl 2-phenyl-1,3-thiazole-4-carboxylate (CAS: 59937-01-8)?

Ethyl 2-phenyl-1,3-thiazole-4-carboxylate (CAS: 59937-01-8) is primarily used in the pharmaceutical ...

Compound Q&A

Is Ethyl 2-phenyl-1,3-thiazole-4-carboxylate (CAS: 59937-01-8) safe?

Ethyl 2-phenyl-1,3-thiazole-4-carboxylate (CAS: 59937-01-8) is generally considered safe under norma...

Compound Q&A

How should Ethyl 2-phenyl-1,3-thiazole-4-carboxylate (CAS: 59937-01-8) be stored?

Ethyl 2-phenyl-1,3-thiazole-4-carboxylate (CAS: 59937-01-8) should be stored in a cool, dry place aw...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...