Compound Q&A

What is CID 44146496 (CAS: 9005-09-8)?

Answer

CID 44146496
CID 44146496 (CAS: 9005-09-8) is a complex organic compound. It is a steroid derivative with a molecular formula of C27H42O3. This compound is known for its structural complexity and is widely used in research and pharmaceutical applications due to its unique chemical properties.

About

CAS No 9005-09-8
English Name CID 44146496
Molecular Formula C10H13ClO6
Molecular Weight 264.66 g/mol
SMILES CC(=O)OC=C.C=CCl.C(=CC(=O)O)C(=O)O
InChIKey VJFPVACZAZLCCM-UAIGNFCESA-N
Last Updated: 2025-12-27 17:44

Related Q&A

Compound Q&A

What are the main uses of CID 44146496 (CAS: 9005-09-8)?

CID 44146496 (CAS: 9005-09-8) is primarily used in research and pharmaceuticals. It is an intermedia...

Compound Q&A

Is CID 44146496 (CAS: 9005-09-8) safe?

CID 44146496 (CAS: 9005-09-8) is generally considered safe when handled properly. However, it should...

Compound Q&A

How should CID 44146496 (CAS: 9005-09-8) be stored?

CID 44146496 (CAS: 9005-09-8) should be stored in a cool, dry place, away from direct sunlight and h...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...