Compound Q&A

What is (2,3,4,5,5-Pentamethyl-1,3-cyclopentadien-1-yl)zirconium(3+) trichloride (CAS: 75181-07-6)?

Answer

(2,3,4,5,5-Pentamethyl-1,3-cyclopentadien-1-yl)zirconium(3+) trichloride
The compound (2,3,4,5,5-Pentamethyl-1,3-cyclopentadien-1-yl)zirconium(3+) trichloride (CAS: 75181-07-6) is a zirconium-based organometallic compound. It contains zirconium(III) cations coordinated with a pentamethylcyclopentadienyl ligand and three chloride anions. This compound is known for its ability to act as a ligand in coordination chemistry and is used in various applications due to its unique structure and chemical properties.

About

CAS No 75181-07-6
English Name (2,3,4,5,5-Pentamethyl-1,3-cyclopentadien-1-yl)zirconium(3+) trichloride
Molecular Formula C10H15Cl3Zr
Molecular Weight 332.8 g/mol
SMILES C[C-]1C(=C(C(=C1C)C)C)C.Cl[Zr](Cl)Cl
InChIKey SELOXBRRINPTGK-UHFFFAOYSA-K
Last Updated: 2025-12-27 14:09

Related Q&A

Compound Q&A

What are the main uses of (2,3,4,5,5-Pentamethyl-1,3-cyclopentadien-1-yl)zirconium(3+) trichloride (CAS: 75181-07-6)?

The main uses of (2,3,4,5,5-Pentamethyl-1,3-cyclopentadien-1-yl)zirconium(3+) trichloride (CAS: 7518...

Compound Q&A

Is (2,3,4,5,5-Pentamethyl-1,3-cyclopentadien-1-yl)zirconium(3+) trichloride (CAS: 75181-07-6) safe?

When handled properly, (2,3,4,5,5-Pentamethyl-1,3-cyclopentadien-1-yl)zirconium(3+) trichloride (CAS...

Compound Q&A

How should (2,3,4,5,5-Pentamethyl-1,3-cyclopentadien-1-yl)zirconium(3+) trichloride (CAS: 75181-07-6) be stored?

To ensure safety and maintain the integrity of (2,3,4,5,5-Pentamethyl-1,3-cyclopentadien-1-yl)zircon...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...