Compound Q&A

What are the main uses of 2',3',4,4',7-Pentahydroxyisoflavan (CAS: 1011711-05-9)?

Answer

2',3',4,4',7-Pentahydroxyisoflavan; (3R,4R)-form, 3',4'-Di-Me ether, 7-O-β-D-glucopyranoside
2',3',4,4',7-Pentahydroxyisoflavan (CAS: 1011711-05-9) is primarily used in pharmaceutical research and development for its potential anti-inflammatory and antioxidant properties. It is also studied for its potential in health supplements and natural product formulations.

About

English Name 2',3',4,4',7-Pentahydroxyisoflavan; (3R,4R)-form, 3',4'-Di-Me ether, 7-O-β-D-glucopyranoside
Molecular Formula C23H28O11
Molecular Weight 480.47 g/mol
SMILES COc1ccc(C2COc3cc(OC4OC(CO)C(O)C(O)C4O)ccc3C2O)c(O)c1OC
InChIKey JTRBZHFVAAWBNR-UHFFFAOYSA-N
Last Updated: 2025-12-27 14:09

Related Q&A

Compound Q&A

What is 2',3',4,4',7-Pentahydroxyisoflavan (CAS: 1011711-05-9)?

2',3',4,4',7-Pentahydroxyisoflavan (CAS: 1011711-05-9) is a flavonoid compound with a unique chemica...

Compound Q&A

Is 2',3',4,4',7-Pentahydroxyisoflavan (CAS: 1011711-05-9) safe?

2',3',4,4',7-Pentahydroxyisoflavan (CAS: 1011711-05-9) is generally considered safe for research and...

Compound Q&A

How should 2',3',4,4',7-Pentahydroxyisoflavan (CAS: 1011711-05-9) be stored?

2',3',4,4',7-Pentahydroxyisoflavan (CAS: 1011711-05-9) should be stored under nitrogen atmosphere at...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...