Compound Q&A

What are the main uses of 2-Methyl 1-(2-methyl-2-propanyl) (2R)-1,2-azetidinedicarboxylate (CAS: 1260593-39-2)?

Answer

2-Methyl 1-(2-methyl-2-propanyl) (2R)-1,2-azetidinedicarboxylate
The main uses of 2-Methyl 1-(2-methyl-2-propanyl) (2R)-1,2-azetidinedicarboxylate include its application as a precursor in the synthesis of other compounds, particularly in the pharmaceutical industry. It is also utilized in research for its unique chemical properties and stability. Additionally, it can be used in some industrial applications due to its specific reactivity and structural features.

About

English Name 2-Methyl 1-(2-methyl-2-propanyl) (2R)-1,2-azetidinedicarboxylate
Molecular Formula C10H17NO4
Molecular Weight 215.25 g/mol
SMILES CC(C)(C)OC(=O)N1CC[C@@H]1C(=O)OC
InChIKey FGWUDHZVEBFGKS-SSDOTTSWSA-N
Last Updated: 2025-12-27 14:09

Related Q&A

Compound Q&A

What is 2-Methyl 1-(2-methyl-2-propanyl) (2R)-1,2-azetidinedicarboxylate (CAS: 1260593-39-2)?

2-Methyl 1-(2-methyl-2-propanyl) (2R)-1,2-azetidinedicarboxylate is a cyclic, symmetric dicarboxylic...

Compound Q&A

Is 2-Methyl 1-(2-methyl-2-propanyl) (2R)-1,2-azetidinedicarboxylate (CAS: 1260593-39-2) safe?

2-Methyl 1-(2-methyl-2-propanyl) (2R)-1,2-azetidinedicarboxylate is generally regarded as safe under...

Compound Q&A

How should 2-Methyl 1-(2-methyl-2-propanyl) (2R)-1,2-azetidinedicarboxylate (CAS: 1260593-39-2) be stored?

2-Methyl 1-(2-methyl-2-propanyl) (2R)-1,2-azetidinedicarboxylate should be stored in a cool, dry, an...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...