Compound Q&A

What is {1-[(Benzyloxy)carbonyl]-3-azetidinyl}acetic acid (CAS: 319470-14-9)?

Answer

{1-[(Benzyloxy)carbonyl]-3-azetidinyl}acetic acid
{1-[(Benzyloxy)carbonyl]-3-azetidinyl}acetic acid is a derivative of acetic acid with a unique molecular structure, featuring an azetidinyl moiety and a benzyloxy carbonyl group. It is used in pharmaceuticals and research for its specific functional groups and structural properties.

About

English Name {1-[(Benzyloxy)carbonyl]-3-azetidinyl}acetic acid
Molecular Formula C13H15NO4
Molecular Weight 249.27 g/mol
SMILES OC(=O)CC1CN(C1)C(=O)OCc2ccccc2
InChIKey LSAPQRPYEJIJAG-UHFFFAOYSA-N
Last Updated: 2025-12-27 10:41

Related Q&A

Compound Q&A

What are the main uses of {1-[(Benzyloxy)carbonyl]-3-azetidinyl}acetic acid (CAS: 319470-14-9)?

This compound is primarily used in pharmaceutical research and development, serving as a starting ma...

Compound Q&A

Is {1-[(Benzyloxy)carbonyl]-3-azetidinyl}acetic acid (CAS: 319470-14-9) safe?

While {1-[(Benzyloxy)carbonyl]-3-azetidinyl}acetic acid is generally safe under controlled condition...

Compound Q&A

How should {1-[(Benzyloxy)carbonyl]-3-azetidinyl}acetic acid (CAS: 319470-14-9) be stored?

{1-[(Benzyloxy)carbonyl]-3-azetidinyl}acetic acid should be stored in a cool, dry place, away from d...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...