Compound Q&A

Is Maoecrystal B (CAS: 96850-29-2) safe?

Answer

Maoecrystal B
Maoecrystal B (CAS: 96850-29-2) is generally considered safe when used under controlled conditions. However, it should be handled with caution due to its potential toxicity. Protective measures include wearing gloves and a laboratory coat, and ensuring adequate ventilation during handling.

About

CAS No 96850-29-2
English Name Maoecrystal B
Molecular Formula C22H28O6
Molecular Weight 388.45 g/mol
SMILES CC(=O)OC1C(=C)C2CCC3C1(C2)C4(C(C5C3(CO4)C(=O)C=CC5(C)C)O)O
InChIKey KNRAGAKNFNKKQF-UHFFFAOYSA-N
Last Updated: 2025-12-27 10:41

Related Q&A

Compound Q&A

What is Maoecrystal B (CAS: 96850-29-2)?

Maoecrystal B (CAS: 96850-29-2) is a polyketide compound isolated from the Chinese yam (Dioscorea ni...

Compound Q&A

What are the main uses of Maoecrystal B (CAS: 96850-29-2)?

Maoecrystal B (CAS: 96850-29-2) is primarily used in research for its bioactive properties, such as ...

Compound Q&A

How should Maoecrystal B (CAS: 96850-29-2) be stored?

Maoecrystal B (CAS: 96850-29-2) should be stored in a cool, dry place away from direct sunlight and ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...