Compound Q&A

Is Maoecrystal B (CAS: 96850-29-2) safe?

Answer

Maoecrystal B
Maoecrystal B (CAS: 96850-29-2) is generally considered safe when used under controlled conditions. However, it should be handled with caution due to its potential toxicity. Protective measures include wearing gloves and a laboratory coat, and ensuring adequate ventilation during handling.

About

CAS No 96850-29-2
English Name Maoecrystal B
Molecular Formula C22H28O6
Molecular Weight 388.4541 g/mol
SMILES CC(=O)OC1C(=C)C2CCC3C1(C2)C4(C(C5C3(CO4)C(=O)C=CC5(C)C)O)O
InChIKey KNRAGAKNFNKKQF-UHFFFAOYSA-N
Last Updated: 2025-12-27 10:41

Related Q&A

Compound Q&A

What is Maoecrystal B (CAS: 96850-29-2)?

Maoecrystal B (CAS: 96850-29-2) is a polyketide compound isolated from the Chinese yam (Dioscorea ni...

Compound Q&A

What are the main uses of Maoecrystal B (CAS: 96850-29-2)?

Maoecrystal B (CAS: 96850-29-2) is primarily used in research for its bioactive properties, such as ...

Compound Q&A

How should Maoecrystal B (CAS: 96850-29-2) be stored?

Maoecrystal B (CAS: 96850-29-2) should be stored in a cool, dry place away from direct sunlight and ...

155412-88-71-(3-Aminophenyl)-3-...
Compound Q&A

How should waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 19132-12-8) be handled?

Waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 191...

19132-12-81-(D-Ribofuranosyl)-...
Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 2007919-81-3)?

2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 20079...

2007919-81-32-Methyl-2-propanyl ...
Compound Q&A

What is N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0)?

N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0) is a chemical compound with...

245056-66-0N-(4-Chloro-2-pyridi...