Compound Q&A

Is Nigranoic acid (CAS: 39111-07-4) safe?

Answer

Nigranoic acid
Nigranoic acid (CAS: 39111-07-4) is generally considered safe when handled properly. However, it can cause skin irritation and respiratory issues if inhaled or exposed to the eyes. Protective measures such as gloves and goggles are recommended, and it should be kept away from heat and open flames.

About

CAS No 39111-07-4
English Name Nigranoic acid
Molecular Formula C30H46O4
Molecular Weight 470.69 g/mol
SMILES CC(CCC=C(C)C(=O)O)C1CCC2(C1(CCC34C2CCC(C3(C4)CCC(=O)O)C(=C)C)C)C
InChIKey NJFOSFIPGRXARF-BRTULJEKSA-N
Last Updated: 2025-12-27 10:41

Related Q&A

Compound Q&A

What is Nigranoic acid (CAS: 39111-07-4)?

Nigranoic acid (CAS: 39111-07-4) is an organic compound with the chemical formula C9H7NO2. It is a c...

Compound Q&A

What are the main uses of Nigranoic acid (CAS: 39111-07-4)?

Nigranoic acid (CAS: 39111-07-4) is primarily used in the synthesis of other chemicals and pharmaceu...

Compound Q&A

How should Nigranoic acid (CAS: 39111-07-4) be stored?

Nigranoic acid (CAS: 39111-07-4) should be stored in a cool, dry place away from direct sunlight and...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...