Compound Q&A

What are the main uses of 4-(Benzyloxy)-3,5-dimethylbenzoic acid (CAS: 97888-80-7)?

Answer

4-(Benzyloxy)-3,5-dimethylbenzoic acid
4-(Benzyloxy)-3,5-dimethylbenzoic acid is primarily used in the pharmaceutical industry for the synthesis of various drugs. It is also utilized in research for its specific functional groups, contributing to the development of new chemical entities and therapeutic agents.

About

CAS No 97888-80-7
English Name 4-(Benzyloxy)-3,5-dimethylbenzoic acid
Molecular Formula C16H16O3
Molecular Weight 256.3 g/mol
SMILES OC(=O)c1cc(C)c(c(c1)C)OCc1ccccc1
InChIKey JABUPJCJZZNUFK-UHFFFAOYSA-N
Last Updated: 2025-12-27 10:41

Related Q&A

Compound Q&A

What is 4-(Benzyloxy)-3,5-dimethylbenzoic acid (CAS: 97888-80-7)?

4-(Benzyloxy)-3,5-dimethylbenzoic acid is a chemical compound with a CAS number of 97888-80-7. It is...

Compound Q&A

Is 4-(Benzyloxy)-3,5-dimethylbenzoic acid (CAS: 97888-80-7) safe?

4-(Benzyloxy)-3,5-dimethylbenzoic acid is generally safe when handled with proper precautions. Howev...

Compound Q&A

How should 4-(Benzyloxy)-3,5-dimethylbenzoic acid (CAS: 97888-80-7) be stored?

4-(Benzyloxy)-3,5-dimethylbenzoic acid should be stored in a cool, dry place away from direct sunlig...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...