Compound Q&A

What is 11-epi-mogroside V (CAS: 2146088-12-0)?

Answer

11-epi-mogroside V
11-epi-mogroside V is a naturally occurring sweetener with a sweet taste similar to sugar. It is a glycoside found in various plants, particularly in the roots of Glycyrrhiza uralensis. The compound has a molecular formula of C31H48O12 and is characterized by its sweet taste and potential health benefits.

About

English Name 11-epi-mogroside V
Molecular Formula C60H102O29
Molecular Weight 1287.45 g/mol
SMILES CC(CCC(OC1OC(COC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O)C(C)(C)O)C1CCC2(C)C3CC=C4C(CCC(OC5OC(COC6OC(CO)C(O)C(O)C6O)C(O)C(O)C5O)C4(C)C)C3(C)C(O)CC12C
InChIKey GHBNZZJYBXQAHG-UHFFFAOYSA-N
Last Updated: 2025-12-27 10:41

Related Q&A

Compound Q&A

What are the main uses of 11-epi-mogroside V (CAS: 2146088-12-0)?

11-epi-mogroside V is primarily used as a natural sweetener in food products, especially in low-calo...

Compound Q&A

Is 11-epi-mogroside V (CAS: 2146088-12-0) safe?

11-epi-mogroside V is generally considered safe for human consumption when used in food products. Ho...

Compound Q&A

How should 11-epi-mogroside V (CAS: 2146088-12-0) be stored?

11-epi-mogroside V should be stored in a cool, dry place away from direct sunlight and heat sources....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...