Compound Q&A

What is N-(2-Methyl-5-nitrophenyl)-4-(3-pyridinyl)-1,3-thiazol-2-amine (CAS: 1048007-94-8)?

Answer

N-(2-Methyl-5-nitrophenyl)-4-(3-pyridinyl)-1,3-thiazol-2-amine
N-(2-Methyl-5-nitrophenyl)-4-(3-pyridinyl)-1,3-thiazol-2-amine (CAS: 1048007-94-8) is a heterocyclic amine compound. It consists of a thiazole ring fused with a pyridine ring and a substituted phenyl group. This compound is characterized by its aromatic structure and exhibits properties typical of nitrogen-containing heterocycles, such as basicity and potential reactivity. It is often used in pharmaceutical research and development for its structural complexity and biological activity.

About

English Name N-(2-Methyl-5-nitrophenyl)-4-(3-pyridinyl)-1,3-thiazol-2-amine
Molecular Formula C15H12N4O2S
Molecular Weight 312.3 g/mol
SMILES CC1=C(C=C(C=C1)[N+](=O)[O-])NC2=NC(=CS2)C3=CN=CC=C3
InChIKey SDDODIFTQFSODB-UHFFFAOYSA-N
Last Updated: 2025-12-27 10:41

Related Q&A

Compound Q&A

What are the main uses of N-(2-Methyl-5-nitrophenyl)-4-(3-pyridinyl)-1,3-thiazol-2-amine (CAS: 1048007-94-8)?

N-(2-Methyl-5-nitrophenyl)-4-(3-pyridinyl)-1,3-thiazol-2-amine (CAS: 1048007-94-8) is primarily used...

Compound Q&A

Is N-(2-Methyl-5-nitrophenyl)-4-(3-pyridinyl)-1,3-thiazol-2-amine (CAS: 1048007-94-8) safe?

N-(2-Methyl-5-nitrophenyl)-4-(3-pyridinyl)-1,3-thiazol-2-amine (CAS: 1048007-94-8) is generally cons...

Compound Q&A

How should N-(2-Methyl-5-nitrophenyl)-4-(3-pyridinyl)-1,3-thiazol-2-amine (CAS: 1048007-94-8) be stored?

N-(2-Methyl-5-nitrophenyl)-4-(3-pyridinyl)-1,3-thiazol-2-amine (CAS: 1048007-94-8) should be stored ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...