Compound Q&A

What are the main uses of N-t-Butyl 4-bromobenzenesulfonamide (CAS: 93281-65-3)?

Answer

N-t-Butyl 4-bromobenzenesulfonamide
N-t-Butyl 4-bromobenzenesulfonamide (CAS: 93281-65-3) is primarily used in pharmaceutical research as a starting material for the synthesis of various medicinal compounds. It also finds use in organic synthesis due to its reactive functional groups, and occasionally in other industrial processes requiring specific chemical properties.

About

CAS No 93281-65-3
English Name N-t-Butyl 4-bromobenzenesulfonamide
Molecular Formula C10H14BrNO2S
Molecular Weight 292.2 g/mol
SMILES CC(C)(C)NS(=O)(=O)C1=CC=C(C=C1)Br
InChIKey NHMNSUKZJWPIQA-UHFFFAOYSA-N
Last Updated: 2025-12-27 10:41

Related Q&A

Compound Q&A

What is N-t-Butyl 4-bromobenzenesulfonamide (CAS: 93281-65-3)?

N-t-Butyl 4-bromobenzenesulfonamide (CAS: 93281-65-3) is an organic compound with the molecular form...

Compound Q&A

Is N-t-Butyl 4-bromobenzenesulfonamide (CAS: 93281-65-3) safe?

N-t-Butyl 4-bromobenzenesulfonamide (CAS: 93281-65-3) is generally considered safe when handled prop...

Compound Q&A

How should N-t-Butyl 4-bromobenzenesulfonamide (CAS: 93281-65-3) be stored?

N-t-Butyl 4-bromobenzenesulfonamide (CAS: 93281-65-3) should be stored in a cool, dry place, away fr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...