Compound Q&A

What is 3-Amino-1-benzhydryl-azetidine mesylate (CAS: 1373253-26-9)?

Answer

3-Amino-1-benzhydryl-azetidine mesylate
3-Amino-1-benzhydryl-azetidine mesylate is a chemical compound with the CAS number 1373253-26-9. It is an azetidine derivative with a benzhydryl group and a mesylate functional group. The compound is characterized by its amine and aromatic structures, which contribute to its chemical stability and reactivity.

About

English Name 3-Amino-1-benzhydryl-azetidine mesylate
Molecular Formula C17H22N2O3S
Molecular Weight 334.44 g/mol
SMILES CS(=O)(=O)O.C1C(CN1C(C2=CC=CC=C2)C3=CC=CC=C3)N
InChIKey JICKOKVDHRVNEZ-UHFFFAOYSA-N
Last Updated: 2025-12-27 06:56

Related Q&A

Compound Q&A

What are the main uses of 3-Amino-1-benzhydryl-azetidine mesylate (CAS: 1373253-26-9)?

3-Amino-1-benzhydryl-azetidine mesylate is primarily used in pharmaceutical research as a potential ...

Compound Q&A

Is 3-Amino-1-benzhydryl-azetidine mesylate (CAS: 1373253-26-9) safe?

3-Amino-1-benzhydryl-azetidine mesylate is generally considered safe when handled appropriately. How...

Compound Q&A

How should 3-Amino-1-benzhydryl-azetidine mesylate (CAS: 1373253-26-9) be stored?

3-Amino-1-benzhydryl-azetidine mesylate should be stored in a cool, dry place away from direct sunli...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...