Compound Q&A

What are the main uses of 4-(4-Chlorophenoxy)butanoic acid (CAS: 3547-07-7)?

Answer

4-(4-Chlorophenoxy)butanoic acid
4-(4-Chlorophenoxy)butanoic acid (4-CPBA, CAS: 3547-07-7) is primarily used in the synthesis of pharmaceuticals, agrochemicals, and dyes. It serves as a key intermediate in organic synthesis for producing various compounds with biological activities. Additionally, it is used in the preparation of herbicides and fungicides due to its chlorophenoxy moiety.

About

CAS No 3547-07-7
English Name 4-(4-Chlorophenoxy)butanoic acid
Molecular Formula C10H11ClO3
Molecular Weight 214.65 g/mol
SMILES C1=CC(=CC=C1OCCCC(=O)O)Cl
InChIKey SIYAHZSHQIPQLY-UHFFFAOYSA-N
Last Updated: 2025-12-27 06:56

Related Q&A

Compound Q&A

What is 4-(4-Chlorophenoxy)butanoic acid (CAS: 3547-07-7)?

4-(4-Chlorophenoxy)butanoic acid, also known as 4-CPBA, is an organic compound with the CAS number 3...

Compound Q&A

Is 4-(4-Chlorophenoxy)butanoic acid (CAS: 3547-07-7) safe?

4-(4-Chlorophenoxy)butanoic acid (4-CPBA, CAS: 3547-07-7) is generally safe when handled according t...

Compound Q&A

How should 4-(4-Chlorophenoxy)butanoic acid (CAS: 3547-07-7) be stored?

4-(4-Chlorophenoxy)butanoic acid (4-CPBA, CAS: 3547-07-7) should be stored in a cool, dry place, awa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...