Compound Q&A

What is 1-[(Benzyloxy)carbonyl]hexahydro-3-pyridazinecarboxylic acid (CAS: 72120-54-8)?

Answer

1-[(Benzyloxy)carbonyl]hexahydro-3-pyridazinecarboxylic acid
1-[(Benzyloxy)carbonyl]hexahydro-3-pyridazinecarboxylic acid is an organic compound with a unique structure. Its CAS number is 72120-54-8. This compound is characterized by its aromatic and carboxylic acid moieties, which contribute to its chemical properties and reactivity. It is often used in pharmaceutical research for its potential as an intermediate or as a raw material in drug synthesis.

About

CAS No 72120-54-8
English Name 1-[(Benzyloxy)carbonyl]hexahydro-3-pyridazinecarboxylic acid
Molecular Formula C13H16N2O4
Molecular Weight 264.28 g/mol
SMILES C1CC(NN(C1)C(=O)OCC2=CC=CC=C2)C(=O)O
InChIKey ZYBMAAOZXXKYTG-UHFFFAOYSA-N
Last Updated: 2025-12-27 06:56

Related Q&A

Compound Q&A

What are the main uses of 1-[(Benzyloxy)carbonyl]hexahydro-3-pyridazinecarboxylic acid (CAS: 72120-54-8)?

1-[(Benzyloxy)carbonyl]hexahydro-3-pyridazinecarboxylic acid (CAS: 72120-54-8) is primarily used in ...

Compound Q&A

Is 1-[(Benzyloxy)carbonyl]hexahydro-3-pyridazinecarboxylic acid (CAS: 72120-54-8) safe?

1-[(Benzyloxy)carbonyl]hexahydro-3-pyridazinecarboxylic acid (CAS: 72120-54-8) is generally consider...

Compound Q&A

How should 1-[(Benzyloxy)carbonyl]hexahydro-3-pyridazinecarboxylic acid (CAS: 72120-54-8) be stored?

1-[(Benzyloxy)carbonyl]hexahydro-3-pyridazinecarboxylic acid (CAS: 72120-54-8) should be stored in a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...